cvelist/2014/2xxx/CVE-2014-2124.json

87 lines
2.8 KiB
JSON
Raw Normal View History

2017-10-16 12:31:07 -04:00
{
2019-03-18 04:25:17 +00:00
"CVE_data_meta": {
"ASSIGNER": "psirt@cisco.com",
"ID": "CVE-2014-2124",
"STATE": "PUBLIC"
},
"affects": {
"vendor": {
"vendor_data": [
{
"product": {
"product_data": [
{
"product_name": "n/a",
"version": {
"version_data": [
{
"version_value": "n/a"
}
]
}
}
]
},
"vendor_name": "n/a"
}
]
}
},
"data_format": "MITRE",
"data_type": "CVE",
"data_version": "4.0",
"description": {
"description_data": [
2017-10-16 12:31:07 -04:00
{
2019-03-18 04:25:17 +00:00
"lang": "eng",
"value": "Cisco IOS 15.1(2)SY3 and earlier, when used with Supervisor Engine 2T (aka Sup2T) on Catalyst 6500 devices, allows remote attackers to cause a denial of service (device crash) via crafted multicast packets, aka Bug ID CSCuf60783."
2017-10-16 12:31:07 -04:00
}
2019-03-18 04:25:17 +00:00
]
},
"problemtype": {
"problemtype_data": [
{
"description": [
{
"lang": "eng",
"value": "n/a"
}
]
}
]
},
"references": {
"reference_data": [
{
"name": "http://tools.cisco.com/security/center/viewAlert.x?alertId=33413",
"refsource": "CONFIRM",
"url": "http://tools.cisco.com/security/center/viewAlert.x?alertId=33413"
},
{
"name": "1029942",
"refsource": "SECTRACK",
"url": "http://www.securitytracker.com/id/1029942"
},
{
"name": "66301",
"refsource": "BID",
"url": "http://www.securityfocus.com/bid/66301"
},
{
"name": "20140319 Cisco IOS Software Sup2T Denial of Service Vulnerability",
"refsource": "CISCO",
"url": "http://tools.cisco.com/security/center/content/CiscoSecurityNotice/CVE-2014-2124"
},
{
"name": "57515",
"refsource": "SECUNIA",
"url": "http://secunia.com/advisories/57515"
},
{
"name": "ciscoios-cve20142124-dos(91904)",
"refsource": "XF",
"url": "https://exchange.xforce.ibmcloud.com/vulnerabilities/91904"
}
]
}
}