mirror of
https://github.com/CVEProject/cvelist.git
synced 2025-12-13 23:37:08 +00:00
77 lines
2.9 KiB
JSON
77 lines
2.9 KiB
JSON
{
|
|
"CVE_data_meta": {
|
|
"ASSIGNER": "psirt@cisco.com",
|
|
"ID": "CVE-2011-3303",
|
|
"STATE": "PUBLIC"
|
|
},
|
|
"affects": {
|
|
"vendor": {
|
|
"vendor_data": [
|
|
{
|
|
"product": {
|
|
"product_data": [
|
|
{
|
|
"product_name": "n/a",
|
|
"version": {
|
|
"version_data": [
|
|
{
|
|
"version_value": "n/a"
|
|
}
|
|
]
|
|
}
|
|
}
|
|
]
|
|
},
|
|
"vendor_name": "n/a"
|
|
}
|
|
]
|
|
}
|
|
},
|
|
"data_format": "MITRE",
|
|
"data_type": "CVE",
|
|
"data_version": "4.0",
|
|
"description": {
|
|
"description_data": [
|
|
{
|
|
"lang": "eng",
|
|
"value": "Cisco Adaptive Security Appliances (ASA) 5500 series devices, and the ASA Services module in Cisco Catalyst 6500 series devices, with software 7.0 before 7.0(8.13), 7.1 and 7.2 before 7.2(5.4), 8.0 before 8.0(5.25), 8.1 before 8.1(2.50), 8.2 before 8.2(5.6), 8.3 before 8.3(2.23), 8.4 before 8.4(2.7), and 8.5 before 8.5(1.1) and Cisco Firewall Services Module (aka FWSM) 3.1 before 3.1(21), 3.2 before 3.2(22), 4.0 before 4.0(16), and 4.1 before 4.1(7) allow remote attackers to cause a denial of service (device reload) via malformed ILS traffic, aka Bug IDs CSCtq57697 and CSCtq57802."
|
|
}
|
|
]
|
|
},
|
|
"problemtype": {
|
|
"problemtype_data": [
|
|
{
|
|
"description": [
|
|
{
|
|
"lang": "eng",
|
|
"value": "n/a"
|
|
}
|
|
]
|
|
}
|
|
]
|
|
},
|
|
"references": {
|
|
"reference_data": [
|
|
{
|
|
"name": "cisco-fwsm-ils-dos(70329)",
|
|
"refsource": "XF",
|
|
"url": "https://exchange.xforce.ibmcloud.com/vulnerabilities/70329"
|
|
},
|
|
{
|
|
"name": "20111005 Multiple Vulnerabilities in Cisco ASA 5500 Series Adaptive Security Appliances and Cisco Catalyst 6500 Series ASA Services Module",
|
|
"refsource": "CISCO",
|
|
"url": "http://www.cisco.com/warp/public/707/cisco-sa-20111005-asa.shtml"
|
|
},
|
|
{
|
|
"name": "20111005 Multiple Vulnerabilities in Cisco Firewall Services Module",
|
|
"refsource": "CISCO",
|
|
"url": "http://www.cisco.com/warp/public/707/cisco-sa-20111005-fwsm.shtml"
|
|
},
|
|
{
|
|
"name": "76090",
|
|
"refsource": "OSVDB",
|
|
"url": "http://osvdb.org/76090"
|
|
}
|
|
]
|
|
}
|
|
} |